CAS 1446478-30-3

4-[Ethyl[(9H-fluoren-9-ylmethoxy)carbonyl]amino]butanoic acid

Description:

4-[Ethyl[(9H-fluoren-9-ylmethoxy)carbonyl]amino]butanoic acid is a synthetic compound characterized by its complex structure, which includes an ethyl group, a fluorenylmethoxycarbonyl (Fmoc) protecting group, and a butanoic acid moiety. This compound is primarily used in peptide synthesis, particularly as a building block in the formation of peptides where the Fmoc group serves as a protective group for the amino functionality. The presence of the fluorenyl group enhances the stability and solubility of the compound, making it suitable for various organic synthesis applications. The butanoic acid component contributes to the overall hydrophobic character of the molecule, which can influence its interactions in biological systems. Additionally, the compound's structure allows for potential applications in drug development and biochemistry, particularly in the design of peptide-based therapeutics. Its unique characteristics, including its molecular weight and functional groups, make it a valuable tool in the field of medicinal chemistry and peptide research.

Formula: C₂₁H₂₃NO₄

InChI: InChI=1S/C21H23NO4/c1-2-22(13-7-12-20(23)24)21(25)26-14-19-17-10-5-3-8-15(17)16-9-4-6-11-18(16)19/h3-6,8-11,19H,2,7,12-14H2,1H3,(H,23,24)

InChI key: InChIKey=MRDVZOZJNZLBSV-UHFFFAOYSA-N

SMILES: C(OC(N(CCCC(O)=O)CC)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2

Synonyms:

• Butanoic acid, 4-[ethyl[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-
• 4-[Ethyl[(9H-fluoren-9-ylmethoxy)carbonyl]amino]butanoic acid

4-[Ethyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]butanoic acid

CAS: 1446478-30-3

Versatile small molecule scaffold

Formula: C₂₁H₂₃NO₄

Purity: Min. 95%

Molecular weight: 353.4 g/mol

Ref: 3D-WHC47830