
CAS 1446786-36-2
:1,1-Dimethylethyl N-[[1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]methyl]carbamate
Description:
1,1-Dimethylethyl N-[[1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]methyl]carbamate, identified by its CAS number 1446786-36-2, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of a dimethyl group, a pyrazole ring, and a trifluoromethyl group, which contribute to its unique chemical properties. The trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity. The presence of the carbamate functional group suggests potential applications in agricultural chemistry, particularly as a pesticide or herbicide, due to its ability to interact with biological systems. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound's specific characteristics, including its molecular weight, solubility, and potential toxicity, would be critical for understanding its applications and safety in various fields.
Formula:C11H16F3N3O2
InChI:InChI=1S/C11H16F3N3O2/c1-10(2,3)19-9(18)15-6-7-5-8(11(12,13)14)17(4)16-7/h5H,6H2,1-4H3,(H,15,18)
InChI key:InChIKey=DAQDUHOHFXLSIG-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(CNC(OC(C)(C)C)=O)=NN1C
Synonyms:- Carbamic acid, N-[[1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]methyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[[1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]methyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.