CAS 144689-93-0: Ethyl 4-(1-hydroxy-1-methylethyl)-2-propyl-1H-imidazole-5-carboxylate
Description:Ethyl 4-(1-hydroxy-1-methylethyl)-2-propyl-1H-imidazole-5-carboxylate, with the CAS number 144689-93-0, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a hydroxy group and a branched alkyl chain enhances its potential for hydrogen bonding and influences its physical properties, such as boiling point and solubility in various solvents. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH and temperature. Proper handling and safety measures should be observed due to the potential hazards associated with chemical substances.
Formula:C12H20N2O3
InChI:InChI=1S/C12H20N2O3/c1-5-7-8-13-9(11(15)17-6-2)10(14-8)12(3,4)16/h16H,5-7H2,1-4H3,(H,13,14)
InChI key:InChIKey=KZBJJAFGNMRRHN-UHFFFAOYSA-N
SMILES:O=C(OCC)C=1NC(=NC1C(O)(C)C)CCC
- Synonyms:
- 1H-Imidazole-4-carboxylic acid,5-(1-hydroxy-1-methylethyl)-2-propyl-,ethyl ester
- 1H-Imidazole-4-carboxylicacid,5-(1-hydroxy-1-methylethyl)-2-propyl-,ethylester
- 1H-Imidazole-5-carboxylic acid, 4-(1-hydroxy-1-methylethyl)-2-propyl-, ethyl ester
- 2-Propyl-5-(1-hydroxy-1-methylethyl)-3H-imidazole-4-carboxylic acid ethyl ester
- 4-(1-Hydroxy-1-Methylethyl)-2-Propyl-1H-Imidazole-5-Carboxylic Acid Ethyl Ester
- 4-(1-Hydroxy-1-methylethyl)-2-propyl-imidazole carboxylic acid ethyl ester
- 4-(1-Hydroxy-1-methylethyl)-2-propylimidazole-5-carboxylic acid ethyl ester
- 5-(1-Hydroxy-1-Methylethyl)-2-Propyl-3H-Imidazole-5-Carboxylic Acid Ethyl Ester
- Ethyl 4-(1-hydroxy-1-methylethyl)-2-propyl-1H-imidazole-5-carboxylate
- Ethyl 4-(1-hydroxy-1-methylethyl)-2-propylimidazole-5-carboxylate
- See more synonyms
- Ethyl 4-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-5-carboxylate
- Ethyl-4-(1-hydroxy-1-methylethyl)-2-propyl-imidazole-5-carboxylate
- ethyl 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylate
- [5-(1-Hydroxyl-1-methylethyl)-2-propyl-imidazol-4-yl] carboxylic acid ethyl ester
