CymitQuimica logo

CAS 144690-07-3

:

Olmesartan intermediate impurity II

Description:
Olmesartan intermediate impurity II, with the CAS number 144690-07-3, is a chemical compound associated with the synthesis of the antihypertensive drug olmesartan medoxomil. This impurity is typically characterized by its molecular structure, which includes specific functional groups that may influence its reactivity and stability. It is generally a white to off-white solid, and its solubility can vary depending on the solvent used. The compound is of interest primarily in pharmaceutical contexts, particularly in quality control and regulatory compliance, as impurities can affect the efficacy and safety of the final drug product. Analytical techniques such as high-performance liquid chromatography (HPLC) and mass spectrometry are commonly employed to identify and quantify this impurity during the manufacturing process. Understanding the characteristics of such impurities is crucial for ensuring the purity of olmesartan formulations and adhering to stringent pharmaceutical standards.
Formula:C11H16N2O3
InChI:InChI=1S/C11H16N2O3/c1-4-6-8-12-9(7(3)14)10(13-8)11(15)16-5-2/h4-6H2,1-3H3,(H,12,13)
InChI key:VZPSJLSTXDBKLC-UHFFFAOYSA-N
SMILES:CCCC1=NC(=C(N1)C(=O)OCC)C(=O)C
Found 6 products.