CAS 144690-33-5: Ethyl 4-(1-hydroxy-1-methylethyl)-2-propyl-1-[[2′-[1-(triphenylmethyl)-1H-tetrazol-5-yl][1,1′-biphenyl]-4-yl]methyl]-1H-imidazole-5-carboxylate
Description:Ethyl 4-(1-hydroxy-1-methylethyl)-2-propyl-1-[[2′-[1-(triphenylmethyl)-1H-tetrazol-5-yl][1,1′-biphenyl]-4-yl]methyl]-1H-imidazole-5-carboxylate, identified by CAS number 144690-33-5, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as an imidazole ring, a carboxylate ester, and a tetrazole moiety. This compound exhibits properties typical of organic esters, including potential solubility in organic solvents and reactivity due to the presence of the carboxylate group. The presence of the triphenylmethyl group suggests potential applications in areas such as pharmaceuticals or materials science, where stability and electronic properties are crucial. Additionally, the compound's structure may confer specific biological activities, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve advanced organic synthesis techniques, and its behavior in various chemical environments would be influenced by the steric and electronic effects of its substituents.
Formula:C45H44N6O3
InChI:InChI=1S/C45H44N6O3/c1-5-18-39-46-41(44(3,4)53)40(43(52)54-6-2)50(39)31-32-27-29-33(30-28-32)37-25-16-17-26-38(37)42-47-48-49-51(42)45(34-19-10-7-11-20-34,35-21-12-8-13-22-35)36-23-14-9-15-24-36/h7-17,19-30,53H,5-6,18,31H2,1-4H3
InChI key:InChIKey=TZQDBKJBKJIHPR-UHFFFAOYSA-N
SMILES:O=C(OCC)C1=C(N=C(N1CC=2C=CC(=CC2)C=3C=CC=CC3C4=NN=NN4C(C=5C=CC=CC5)(C=6C=CC=CC6)C=7C=CC=CC7)CCC)C(O)(C)C
- Synonyms:
- 1H-IMidazole-5-carboxylic acid, 4-(1-hydroxy-1-Methylethyl)-2-propyl-1-[[2'-[1-(triphenylMethyl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]Methyl]-, ethyl ester
- 4-(1-Hydroxy-1-methylethyl)-2-propyl-1-[[2'-[(triphenylmethyl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]methyl]-1H-imidazole-5-carboxylic acid ethyl ester)
- Ethyl 4-(1-hydroxy-1-methylethyl)-2-propyl-1-[4-[2-(trityltetrazol-5-yl)phenyl]phenyl]methylimidazole-5-carboxylate
- Ethyl 4-(1-hydroxy-1-methylethyl)-2-propyl-1-[[2′-[1-(triphenylmethyl)-1H-tetrazol-5-yl][1,1′-biphenyl]-4-yl]methyl]-1H-imidazole-5-carboxylate
- Trityl olmesartan ethyl ester
- Tritylolmesartan ethyl ester

Ethyl 4-(1-hydroxy-1-methylethyl)-2-propyl-1-[4-[2-(trityltetrazol-5-yl)phenyl]phenyl]methylimidazole-5-carboxylate
Ref: IN-DA001K07
1g | 61.00 € | ||
5g | 142.00 € | ||
10g | 151.00 € | ||
250mg | 41.00 € |

Olmesartan Ethyl Ester Trityl Impurity
Ref: 4Z-O-0819
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

4-(1-Hydroxy-1-methylethyl)-2-propyl-1[4-[2-(trityltetrazol-5-yl)phenyl]phenyl]methylimidazo-5-carboxylate ethyl
Ref: 3D-IH57930
1kg | 1,382.00 € | ||
250g | 343.00 € | ||
500g | 484.00 € |