CAS 144693-65-2
:4-Ethynylbenzoic acid sodium salt
Description:
4-Ethynylbenzoic acid sodium salt is a chemical compound characterized by its unique structure, which includes an ethynyl group attached to a benzoic acid moiety. As a sodium salt, it is typically soluble in water, which enhances its utility in various applications, particularly in organic synthesis and materials science. The compound exhibits acidic properties due to the carboxylate group, allowing it to participate in acid-base reactions. Its ethynyl substituent can engage in further chemical reactions, such as cross-coupling reactions, making it valuable in the synthesis of more complex organic molecules. Additionally, 4-Ethynylbenzoic acid sodium salt may exhibit interesting thermal and photophysical properties, which can be exploited in the development of functional materials, including polymers and dyes. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed. Overall, this compound serves as an important building block in organic chemistry and materials research.
Formula:C9H5NaO2
InChI:InChI=1/C9H6O2.Na/c1-2-7-3-5-8(6-4-7)9(10)11;/h1,3-6H,(H,10,11);/q;+1/p-1
SMILES:C#Cc1ccc(cc1)C(=O)O.[Na]
Synonyms:- (4-Carboxyphenyl)acetylene sodium salt~Sodium 4-ethynylbenzoate
- Sodium 4-Ethynylbenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Sodium 4-ethynylbenzoate, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H5NaO2Purity:97%Color and Shape:Yellow to cream to orange to pale brown, Crystals or powder or crystalline powderMolecular weight:168.13Benzoic acid, 4-ethynyl-, sodium salt (1:1)
CAS:Formula:C9H5NaO2Purity:97%Color and Shape:SolidMolecular weight:168.12464-Ethynylbenzoic acid sodium
CAS:Please enquire for more information about 4-Ethynylbenzoic acid sodium including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C9H6O2•NaPurity:Min. 95%Molecular weight:169.13 g/mol




