CymitQuimica logo

CAS 144696-36-6

:

10(9H)-Acridineacetic acid, 9-oxo-, sodium salt (1:1)

Description:
10(9H)-Acridineacetic acid, 9-oxo-, sodium salt (1:1) is a chemical compound characterized by its acridine backbone, which is a fused ring structure known for its aromatic properties. This compound features a carboxylic acid functional group, contributing to its acidic nature, and a ketone group, which enhances its reactivity. As a sodium salt, it is typically more soluble in water compared to its acid form, making it useful in various biological and chemical applications. The presence of the acridine moiety suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or anticancer agents, due to the known biological activities of acridine derivatives. Additionally, the compound may exhibit fluorescence properties, which can be advantageous in analytical chemistry and biological imaging. Its molecular structure allows for interactions with biological macromolecules, potentially influencing its pharmacokinetics and bioavailability. Overall, this compound represents a unique intersection of organic chemistry and medicinal applications, warranting further investigation into its properties and uses.
Formula:C15H11NO3·Na
InChI:InChI=1S/C15H11NO3.Na/c17-14(18)9-16-12-7-3-1-5-10(12)15(19)11-6-2-4-8-13(11)16;/h1-8H,9H2,(H,17,18);
InChI key:InChIKey=DTBMZZDVZAZJNU-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1C=2C(C(=O)C=3C1=CC=CC3)=CC=CC2.[Na]
Synonyms:
  • 10-Carboxymethyl-9-acridanone sodium salt
  • 10(9H)-Acridineacetic acid, 9-oxo-, sodium salt (1:1)
  • Sodium 9-oxo-10-acridineacetate
  • 10(9H)-Acridineacetic acid, 9-oxo-, sodium salt
  • L 1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.