CAS 1447-13-8
:Cyclopropanecarboxylic acid, 2,2-dichloro-1-methyl-, methyl ester
Description:
Cyclopropanecarboxylic acid, 2,2-dichloro-1-methyl-, methyl ester, with CAS number 1447-13-8, is an organic compound characterized by its cyclopropane ring structure and the presence of a carboxylic acid functional group. This compound features two chlorine atoms and a methyl group attached to the cyclopropane, contributing to its unique reactivity and properties. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the ester functional group indicates that it can undergo hydrolysis to form the corresponding acid and alcohol. This compound is of interest in various chemical syntheses and may exhibit biological activity, making it relevant in fields such as medicinal chemistry and agrochemicals. Its physical properties, such as boiling point and solubility, can vary based on environmental conditions and purity. Safety precautions should be taken when handling this compound, as it may pose health risks due to its chlorinated nature.
Formula:C6H8Cl2O2
InChI:InChI=1/C6H8Cl2O2/c1-5(4(9)10-2)3-6(5,7)8/h3H2,1-2H3
InChI key:InChIKey=JGCAZFUFORGMFB-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1(C)C(Cl)(Cl)C1
Synonyms:- 2-Carbomethoxy-2-methyl-1,1-dichlorocyclopropane
- Methyl 2,2-dichloro-1-methylcyclopropanecarboxylate
- Cyclopropanecarboxylic acid, 2,2-dichloro-1-methyl-, methyl ester
- 2,2-Dichloro-1-methylcyclopropanecarboxylic acid methyl ester
- 2,2-Dichloro-1-methylcyclopropane-carboxylic acid methyl ester
- methyl 2,2-dichloro-1-methylcyclopropane-1-carboxylate
- Methyl 2,2-dichloro-1-Methyl-cyclopropanecarbxoylate
- 1-Methyl-2,2-dichlorocyclopropane-1-carboxylic acid methyl ester
- methyl 2,2-dichloro-1-methyl-cyclopropane-1-carboxylate
- 2,2-Dichloro-1-methyl-1-cyclopropanecarboxylic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cyclopropanecarboxylic acid, 2,2-dichloro-1-methyl-, methyl ester
CAS:Formula:C6H8Cl2O2Purity:98%Color and Shape:LiquidMolecular weight:183.0325Methyl 2,2-dichloro-1-methylcyclopropane-1-carboxylate
CAS:Methyl 2,2-dichloro-1-methylcyclopropane-1-carboxylatePurity:98%Methyl 2,2-dichloro-1-methylcyclopropanecarboxylate
CAS:Methyl 2,2-dichloro-1-methylcyclopropanecarboxylate is a cyclic compound with an effective rate of 11.6 s−1. It has been shown to be an effective catalyst for the electrochemical reduction of anthracene and other aromatic compounds in metallocomplexes. The catalytic activity of Methyl 2,2-dichloro-1-methylcyclopropanecarboxylate is dependent on the concentration and type of anion present in solution. In homogeneous systems, this compound is catalytically active for the electrochemical reduction of radical anions and polarographic oxidation of pyridine. This chemical also shows high electrochemical reductive activity towards palladium.
Formula:C6H8Cl2O2Purity:Min. 95%Molecular weight:183.03 g/mol



