CymitQuimica logo

CAS 1447-87-6

:

6-METHOXY-1,2,3,4-TETRAHYDRO-NAPHTHALEN-2-OL

Description:
6-Methoxy-1,2,3,4-tetrahydro-naphthalen-2-ol, with the CAS number 1447-87-6, is an organic compound characterized by its bicyclic structure, which includes a naphthalene core modified by a methoxy group and a hydroxyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents and exhibits moderate polarity due to the presence of the hydroxyl group. The methoxy group contributes to its reactivity and potential as a precursor in organic synthesis. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and purity. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C11H14O2
InChI:InChI=1S/C11H14O2/c1-13-11-5-3-8-6-10(12)4-2-9(8)7-11/h3,5,7,10,12H,2,4,6H2,1H3
InChI key:HQYTZERMKCBGHG-UHFFFAOYSA-N
SMILES:COC1=CC2=C(CC(CC2)O)C=C1
Found 5 products.