CAS 14474-71-6

2,5-Piperazinedione, 3-benzyl-6-isopropyl-

Description:

2,5-Piperazinedione, 3-benzyl-6-isopropyl- is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a benzyl group and an isopropyl group, contributing to its unique structural and chemical properties. It is typically classified as a cyclic urea derivative, which can exhibit various biological activities, making it of interest in medicinal chemistry. The presence of the benzyl and isopropyl substituents can influence its solubility, reactivity, and interaction with biological targets. The compound may be synthesized through specific organic reactions involving piperazine derivatives and appropriate acylating agents. Its applications may extend to pharmaceuticals, where it could serve as a scaffold for drug development. However, detailed information regarding its specific properties, such as melting point, boiling point, and solubility, would require empirical data or literature references for precise characterization. As with many chemical substances, safety data and handling precautions should be consulted before use.

Formula: C₁₄H₁₈N₂O₂

InChI: InChI=1/C14H18N2O2/c1-9(2)12-14(18)15-11(13(17)16-12)8-10-6-4-3-5-7-10/h3-7,9,11-12H,8H2,1-2H3,(H,15,18)(H,16,17)

SMILES: CC(C)C1C(=NC(Cc2ccccc2)C(=N1)O)O

Synonyms:

• 3-Benzyl-6-isopropyl-2,5-piperazinedione
• 3-Benzyl-6-(Propan-2-Yl)Piperazine-2,5-Dione

Cyclo(Phe-Val)

CAS: 14474-71-6

Cyclo(Phe-Val) is a new cell cycle inhibitor, it shows cyctoxic activity in vitro.

Formula: C₁₄H₁₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 246.3

Ref: TM-TN6677

3-Benzyl-6-isopropyl-2,5-Piperazinedione-d5

CAS: 14474-71-6

Formula: C₁₄H₁₃D₅N₂O₂

Molecular weight: 251.34

Ref: 4Z-V-047009

3-Benzyl-6-isopropyl-2,5-Piperazinedione

CAS: 14474-71-6

Formula: C₁₄H₁₈N₂O₂

Molecular weight: 246.31

Ref: 4Z-V-047008

Cyclo(Phe-Val)

CAS: 14474-71-6

Cyclo(Phe-Val) is a cyclic dipeptide, which is a secondary metabolite commonly found in microbial and fungal origins. This compound is classified as a diketopiperazine, which is a class of cyclic dipeptides formed by a peptide bond between two amino acids—in this case, phenylalanine and valine. Cyclo(Phe-Val) is produced through the enzymatic actions of various microorganisms and fungi during their metabolism. Its mode of action is primarily based on its ability to disrupt microbial cell membranes and interfere with cellular processes crucial for the survival of certain pathogens.

Formula: C₁₄H₁₈N₂O₂

Purity: Min. 95%

Molecular weight: 246.30 g/mol

Ref: 3D-PAA47471