CymitQuimica logo

CAS 144740-53-4

:

methyl 2-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-6-(trifluoromethyl)pyridine-3-carboxylate

Description:
Methyl 2-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-6-(trifluoromethyl)pyridine-3-carboxylate, with CAS number 144740-53-4, is a complex organic compound characterized by its unique structural features, including a pyridine ring, a pyrimidine moiety, and multiple functional groups such as a sulfamoyl group and trifluoromethyl substituent. This compound exhibits properties typical of sulfonamide derivatives, which often include antibacterial activity due to their ability to inhibit bacterial folate synthesis. The presence of the trifluoromethyl group may enhance lipophilicity and biological activity, while the methoxy groups on the pyrimidine ring can influence solubility and reactivity. Additionally, the methyl ester functionality suggests potential for hydrolysis, leading to the release of the corresponding carboxylic acid. Overall, this compound's intricate structure and functional groups contribute to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.
Formula:C15H14F3N5O7S
InChI:InChI=1/C15H14F3N5O7S/c1-28-9-6-10(29-2)21-13(20-9)22-14(25)23-31(26,27)11-7(12(24)30-3)4-5-8(19-11)15(16,17)18/h4-6H,1-3H3,(H2,20,21,22,23,25)
SMILES:COc1cc(nc(n1)N=C(NS(=O)(=O)c1c(ccc(C(F)(F)F)n1)C(=O)OC)O)OC
Synonyms:
  • 3-Pyridinecarboxylic Acid, 2-[[[[(4,6-Dimethoxy-2-Pyrimidinyl)Amino]Carbonyl]Amino]Sulfonyl]-6-(Trifluoromethyl)-, Methyl Ester
  • Methyl 2-{[(4,6-dimethoxy-2-pyrimidinyl)carbamoyl]sulfamoyl}-6-(trifluoromethyl)nicotinate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.