CymitQuimica logo

CAS 1447608-08-3

:

Spiro[2H-indene-2,4′-piperidin]-3(1H)-one, 6-fluoro-, hydrochloride (1:1)

Description:
Spiro[2H-indene-2,4′-piperidin]-3(1H)-one, 6-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which combines an indene moiety with a piperidine ring. The presence of a fluorine atom at the 6-position of the indene contributes to its chemical reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The compound may exhibit properties relevant to medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions with biological targets would depend on the functional groups present and the overall molecular conformation. Additionally, the compound's stability, solubility, and potential toxicity would be important factors to consider in its application. Overall, this substance represents a class of compounds that may have significant implications in drug discovery and development.
Formula:C13H14FNO·ClH
InChI:InChI=1S/C13H14FNO.ClH/c14-10-1-2-11-9(7-10)8-13(12(11)16)3-5-15-6-4-13;/h1-2,7,15H,3-6,8H2;1H
InChI key:InChIKey=PGSORMHQTMAJOI-UHFFFAOYSA-N
SMILES:O=C1C2(CC=3C1=CC=C(F)C3)CCNCC2.Cl
Synonyms:
  • Spiro[2H-indene-2,4′-piperidin]-3(1H)-one, 6-fluoro-, hydrochloride (1:1)
  • 5-Fluoro-1,3-dihydrospiro[indene-2,4′-piperidine]-1-one hydrochloride
Found 1 products.