CAS 1447671-85-3

1-Methyl-4-[(3,3,3-trifluoropropyl)thio]benzene

Description:

1-Methyl-4-[(3,3,3-trifluoropropyl)thio]benzene, with the CAS number 1447671-85-3, is an organic compound characterized by the presence of a methyl group and a trifluoropropylthio substituent on a benzene ring. This compound features a thioether functional group, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The trifluoropropyl group imparts unique properties such as increased lipophilicity and potential for enhanced biological activity due to the presence of fluorine atoms, which can influence molecular interactions. The compound is likely to exhibit moderate to low volatility and may have specific solubility characteristics depending on the solvent used. Its structural features suggest potential uses in synthesis and as an intermediate in the production of more complex molecules. Safety and handling precautions should be observed, as with many organofluorine compounds, due to potential toxicity and environmental concerns.

Formula: C₁₀H₁₁F₃S

InChI: InChI=1S/C10H11F3S/c1-8-2-4-9(5-3-8)14-7-6-10(11,12)13/h2-5H,6-7H2,1H3

InChI key: InChIKey=ZAQJONAKRUIBIC-UHFFFAOYSA-N

SMILES: S(CCC(F)(F)F)C1=CC=C(C)C=C1

Synonyms:

• Benzene, 1-methyl-4-[(3,3,3-trifluoropropyl)thio]-
• 1-Methyl-4-[(3,3,3-trifluoropropyl)thio]benzene

3,3,3-Trifluoropropyl p-tolyl sulfide

CAS: 1447671-85-3

Formula: C₁₀H₁₁F₃S

Purity: 99.0%

Molecular weight: 220.25

Ref: 10-F094766