CAS 144796-96-3

N6-(4-Amino-1-β-D-ribofuranosyl-2(1H)-pyrimidinylidene)-L-lysine

Description:

N6-(4-Amino-1-β-D-ribofuranosyl-2(1H)-pyrimidinylidene)-L-lysine, with the CAS number 144796-96-3, is a chemical compound that features a complex structure combining elements of both nucleosides and amino acids. This substance is characterized by the presence of a ribofuranosyl moiety, which is a sugar component, linked to a pyrimidine base that contains an amino group, contributing to its biological activity. The L-lysine component introduces a positively charged amino acid side chain, which can influence the compound's solubility and interaction with biological systems. This compound is of interest in biochemical research, particularly in studies related to nucleic acid metabolism and potential therapeutic applications. Its unique structure allows it to participate in various biochemical pathways, potentially acting as a substrate or inhibitor in enzymatic reactions. Overall, the combination of its ribose sugar, pyrimidine base, and lysine side chain makes it a significant molecule for further exploration in medicinal chemistry and molecular biology.

Formula: C₁₅H₂₅N₅O₆

InChI: InChI=1S/C15H25N5O6/c16-8(14(24)25)3-1-2-5-18-15-19-10(17)4-6-20(15)13-12(23)11(22)9(7-21)26-13/h4,6,8-9,11-13,21-23H,1-3,5,7,16H2,(H,24,25)(H2,17,18,19)/t8-,9+,11+,12+,13+/m0/s1

InChI key: InChIKey=MDWUIKMWKDMPDE-IINAIABHSA-N

SMILES: O[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C(=NCCCC[C@@H](C(O)=O)N)N=C(N)C=C2

Synonyms:

• L-Lysine, N6-(4-amino-1-β-D-ribofuranosyl-2(1H)-pyrimidinylidene)-
• N6-(4-Amino-1-β-D-ribofuranosyl-2(1H)-pyrimidinylidene)-L-lysine

Lysidine

CAS: 144796-96-3

Derivative of cytidine found in tRNA which enhances translation fidelity

Formula: C₁₅H₂₅N₅O₆

Purity: Min. 95%

Molecular weight: 371.39 g/mol

Ref: 3D-NA46541