
CAS 1447962-28-8
:6-(2-Fluorophenyl)-2-methyl-3-pyridinecarboxaldehyde
Description:
6-(2-Fluorophenyl)-2-methyl-3-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a carboxaldehyde functional group (-CHO) indicates that it is an aldehyde, which typically contributes to its reactivity, particularly in nucleophilic addition reactions. The compound features a 2-fluorophenyl substituent, which can influence its electronic properties and potentially enhance its lipophilicity due to the presence of the fluorine atom. The methyl group at the 2-position of the pyridine ring adds to the compound's steric and electronic characteristics. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its specific properties, such as solubility, boiling point, and melting point, would depend on the molecular interactions and the overall structure, which can be further explored through experimental studies or computational modeling.
Formula:C13H10FNO
InChI:InChI=1S/C13H10FNO/c1-9-10(8-16)6-7-13(15-9)11-4-2-3-5-12(11)14/h2-8H,1H3
InChI key:InChIKey=GTPFJVYAGOEQCZ-UHFFFAOYSA-N
SMILES:FC1=C(C=2N=C(C)C(C=O)=CC2)C=CC=C1
Synonyms:- 3-Pyridinecarboxaldehyde, 6-(2-fluorophenyl)-2-methyl-
- 6-(2-Fluorophenyl)-2-methyl-3-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.