CymitQuimica logo

CAS 144797-57-9

:

3,5-Difluoro-4-chlorobenzonitrile

Description:
3,5-Difluoro-4-chlorobenzonitrile is an aromatic compound characterized by the presence of a benzene ring substituted with two fluorine atoms and one chlorine atom, along with a nitrile functional group (-C≡N). The fluorine atoms are located at the 3 and 5 positions, while the chlorine is at the 4 position relative to the nitrile group. This compound typically exhibits a high degree of polarity due to the electronegative halogen substituents, which can influence its reactivity and solubility in various solvents. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the nitrile group contributes to its potential as a building block in further chemical transformations. Additionally, the compound's physical properties, such as melting point and boiling point, are influenced by its molecular structure and the interactions between its substituents. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C7H2ClF2N
InChI:InChI=1S/C7H2ClF2N/c8-7-5(9)1-4(3-11)2-6(7)10/h1-2H
InChI key:FLWUCEPAGLEAML-UHFFFAOYSA-N
SMILES:C1=C(C=C(C(=C1F)Cl)F)C#N
Synonyms:
  • Benzonitrile, 4-chloro-3,5-difluoro-
  • 4-Chloro-3,5-difluorobenzonitrile
Found 4 products.