CymitQuimica logo

CAS 1448-16-4

:

Octanedial, 2,7-dioxo-, N,N-dione

Description:
Octanedial, 2,7-dioxo-, N,N-dione, also known by its CAS number 1448-16-4, is an organic compound characterized by its structure, which features a long carbon chain with two ketone functional groups. This compound typically exhibits a linear arrangement of eight carbon atoms, with the dioxo groups located at the 2 and 7 positions of the chain. As a diketone, it is likely to participate in various chemical reactions, including condensation and oxidation processes. The presence of the carbonyl groups contributes to its reactivity, making it useful in synthetic organic chemistry. Octanedial may also exhibit properties such as solubility in organic solvents and potential applications in the synthesis of more complex molecules. Its physical properties, such as boiling point and melting point, would depend on the specific molecular interactions and the presence of functional groups. Overall, Octanedial, 2,7-dioxo-, N,N-dione is a versatile compound with potential applications in various chemical syntheses and research contexts.
Formula:C8H10N4O2
InChI:InChI=1S/C8H10N4O2/c9-11-5-7(13)3-1-2-4-8(14)6-12-10/h5-6H,1-4H2
InChI key:InChIKey=VFZYDBOHAXCBKP-UHFFFAOYSA-N
SMILES:C(CCCCC(C=[N+]=[N-])=O)(C=[N+]=[N-])=O
Synonyms:
  • Octanedial, 2,7-dioxo-, N,N-dione
  • 1,4-bis-Diazoacetylbutane
  • Bis(diazoacetyl)butane
  • 1,4-Bis(diazoacetyl)butane
  • 2,7-Octanedione, 1,8-bis(diazo)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.