CAS 1448189-81-8

4-[(1,1-Dimethylethoxy)carbonyl]-α-methyl-2-oxo-1-piperazineacetic acid

Description:

4-[(1,1-Dimethylethoxy)carbonyl]-α-methyl-2-oxo-1-piperazineacetic acid is a chemical compound characterized by its unique structure, which includes a piperazine ring, a carbonyl group, and an α-methyl substituent. This compound features a dimethylethoxycarbonyl group, which contributes to its lipophilicity and potential reactivity. The presence of the piperazine moiety suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The carboxylic acid functional group indicates that it can participate in acid-base reactions, making it a versatile compound in synthetic chemistry. Additionally, the compound's molecular structure may influence its solubility, stability, and biological activity, which are critical factors in drug design and development. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with potential therapeutic applications.

Formula: C₁₂H₂₀N₂O₅

InChI: InChI=1S/C12H20N2O5/c1-8(10(16)17)14-6-5-13(7-9(14)15)11(18)19-12(2,3)4/h8H,5-7H2,1-4H3,(H,16,17)

InChI key: InChIKey=IYLXSDCYHQDJFQ-UHFFFAOYSA-N

SMILES: C(C(O)=O)(C)N1C(=O)CN(C(OC(C)(C)C)=O)CC1

Synonyms:

• 2-(4-(tert-Butoxycarbonyl)-2-oxopiperazin-1-yl)propanoic acid
• 4-[(1,1-Dimethylethoxy)carbonyl]-α-methyl-2-oxo-1-piperazineacetic acid
• 1-Piperazineacetic acid, 4-[(1,1-dimethylethoxy)carbonyl]-α-methyl-2-oxo-

2-{4-[(tert-Butoxy)carbonyl]-2-oxopiperazin-1-yl}propanoic acid

CAS: 1448189-81-8

Versatile small molecule scaffold

Formula: C₁₂H₂₀N₂O₅

Purity: Min. 95%

Molecular weight: 272.3 g/mol

Ref: 3D-YHC18981