CAS 1448326-33-7
:5-Bromo-3-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-pyridinamine
Description:
5-Bromo-3-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-pyridinamine is a chemical compound characterized by its complex structure, which includes a pyridine ring, a bromine atom, and an ethoxy group attached to a chiral center. The presence of the bromine atom contributes to its reactivity and potential applications in medicinal chemistry. The dichloro and fluorine substituents on the phenyl ring enhance its biological activity and lipophilicity, which can influence its pharmacokinetic properties. This compound is likely to exhibit specific interactions with biological targets, making it of interest in drug discovery and development. Its chiral nature suggests that it may exhibit stereoselectivity in biological systems, which is an important consideration in the design of pharmaceuticals. Additionally, the CAS number 1448326-33-7 allows for precise identification and retrieval of information regarding its properties, synthesis, and potential applications in various fields, including medicinal chemistry and agrochemicals.
Formula:C13H10BrCl2FN2O
InChI:InChI=1S/C13H10BrCl2FN2O/c1-6(11-8(15)2-3-9(17)12(11)16)20-10-4-7(14)5-19-13(10)18/h2-6H,1H3,(H2,18,19)/t6-/m0/s1
InChI key:InChIKey=URFUZAZEKBBCEY-LURJTMIESA-N
SMILES:[C@H](OC1=C(N)N=CC(Br)=C1)(C)C2=C(Cl)C(F)=CC=C2Cl
Synonyms:- 2-Pyridinamine, 5-bromo-3-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-
- (S)-5-Bromo-3-(1-(2,6-dichloro-3-fluorophenyl)-ethoxy)pyridin-2-amine
- 5-Bromo-3-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(S)-5-Bromo-3-(1-(2,6-dichloro-3-fluorophenyl)ethoxy)pyridin-2-amine
CAS:Formula:C13H10BrCl2FN2OMolecular weight:380.0397(S)-5-Bromo-3-(1-(2,6-dichloro-3-fluorophenyl)ethoxy)pyridin-2-amine
CAS:Formula:C13H10BrCl2FN2OMolecular weight:380.04

