CAS 14486-05-6
:H-Ala-Met-OH
Description:
The chemical substance known as H-Ala-Met-OH, with the CAS number 14486-05-6, is a peptide that consists of the amino acids alanine (Ala) and methionine (Met) linked by a peptide bond. This compound is characterized by its structure, which includes an amino group, a carboxyl group, and a side chain specific to each amino acid. H-Ala-Met-OH is typically classified as a hydrophilic molecule due to the presence of polar functional groups, which can influence its solubility in water. The presence of methionine, which contains a sulfur atom, may also impart unique properties such as the ability to participate in redox reactions. Peptides like H-Ala-Met-OH are often studied for their biological activity, including potential roles in signaling pathways and as precursors to larger proteins. Additionally, they may exhibit various physiological effects, making them of interest in fields such as biochemistry and pharmacology. Overall, H-Ala-Met-OH represents a small but significant component of the vast array of biological molecules.
Formula:C8H16N2O3S
InChI:InChI=1/C8H16N2O3S/c1-5(9)7(11)10-6(8(12)13)3-4-14-2/h5-6H,3-4,9H2,1-2H3,(H,10,11)(H,12,13)
InChI key:InChIKey=FSHURBQASBLAPO-WDSKDSINSA-N
SMILES:[C@H](NC([C@H](C)N)=O)(CCSC)C(O)=O
Synonyms:- 170: PN: WO2012174478 SEQID: 180 unclaimed protein
- 171: PN: WO2012174480 SEQID: 180 unclaimed protein
- 35: PN: WO2005081628 SEQID: 1035 claimed protein
- 46: PN: EP2161028 PAGE: 10 claimed protein
- 4: PN: JP2019099488 SEQID: 4 claimed protein
- 4: PN: WO2019107057 SEQID: 4 claimed protein
- 79: PN: WO2014170713 SEQID: 185 claimed protein
- <span class="text-smallcaps">L</smallcap>-Alanyl-<smallcap>L</span>-methionine
- <span class="text-smallcaps">L</smallcap>-Methionine, <smallcap>L</span>-alanyl-
- <span class="text-smallcaps">L</smallcap>-Methionine, N-<smallcap>L</span>-alanyl-
- Ala-Met
- Alanylmethionine
- L-Alanyl-L-methionine
- Methionine, N-<span class="text-smallcaps">L</smallcap>-alanyl-, <smallcap>L</span>-
- Methionine, N-L-alanyl-, L-
- L-Methionine, N-L-alanyl-
- L-Methionine, L-alanyl-
- (2S)-2-[[(2S)-2-azanylpropanoyl]amino]-4-methylsulfanyl-butanoic acid
- H-ALA-MET-OH
- (S)-2-[[(S)-2-Aminopropionyl]amino]-4-(methylthio)butyric acid
- L-Ala-L-Met-OH
- N-L-Alanyl-L-methionine
- (2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-(methylthio)butyric acid
- (2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylsulfanylbutanoic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
H-Ala-Met-OH
CAS:Bachem ID: 4014205.
Formula:C8H16N2O3SPurity:> 99%Color and Shape:White PowderMolecular weight:220.29H-Ala-Met-OH
CAS:H-Ala-Met-OH is a hydrophobic amino acid. It is found in the sequence of a number of proteins, including hormones and enzymes. The optimum temperature for this amino acid is around 15 degrees Celsius, which is why it can be found in the cocrystallized dodecyl and racemized divalent forms. H-Ala-Met-OH has been shown to have divalent properties due to its ability to bind with two metal ions at the same time. H-Ala-Met-OH also has an amino acid sequence that can be found in many different proteins and enzymes, such as N-acetyl-L-tyrosine. This amino acid has been used as a target for bioinformatics studies on hormone sequences for the reaction mechanism.Formula:C8H16N2O3SPurity:Min. 95%Molecular weight:220.29 g/mol


