CAS 1448608-06-7: N-[(1S,2S)-2-[[[[(1R,2R)-2-(Dimethylamino)cyclohexyl]amino]thioxomethyl]amino]-1,2-diphenylethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide
Description:The chemical substance N-[(1S,2S)-2-[[[[(1R,2R)-2-(Dimethylamino)cyclohexyl]amino]thioxomethyl]amino]-1,2-diphenylethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide, with CAS number 1448608-06-7, is a complex organic compound characterized by its multi-functional groups and stereochemistry. It features a sulfonamide moiety, which is known for its biological activity, particularly in pharmaceuticals. The presence of trifluoromethyl groups enhances lipophilicity and can influence the compound's pharmacokinetic properties. The compound's stereocenters contribute to its potential specificity in biological interactions, making it relevant in medicinal chemistry. Additionally, the dimethylamino group may impart basicity, affecting solubility and reactivity. Overall, this substance is likely to exhibit significant biological activity, potentially serving as a lead compound in drug development, particularly in areas targeting specific receptors or enzymes. Its structural complexity suggests that it may undergo various chemical reactions, making it a subject of interest for further research in both synthetic and medicinal chemistry.
Formula:C31H34F6N4O2S2
InChI:InChI=1S/C31H34F6N4O2S2/c1-41(2)26-16-10-9-15-25(26)38-29(44)39-27(20-11-5-3-6-12-20)28(21-13-7-4-8-14-21)40-45(42,43)24-18-22(30(32,33)34)17-23(19-24)31(35,36)37/h3-8,11-14,17-19,25-28,40H,9-10,15-16H2,1-2H3,(H2,38,39,44)/t25-,26-,27+,28+/m1/s1
InChI key:InChIKey=ZRDOOGDGPMAXLS-VIJSPRBVSA-N
SMILES:O=S(=O)(NC(C=1C=CC=CC1)C(NC(=S)NC2CCCCC2N(C)C)C=3C=CC=CC3)C=4C=C(C=C(C4)C(F)(F)F)C(F)(F)F
- Synonyms:
- Benzenesulfonamide, N-[(1S,2S)-2-[[[[(1R,2R)-2-(dimethylamino)cyclohexyl]amino]thioxomethyl]amino]-1,2-diphenylethyl]-3,5-bis(trifluoromethyl)-
- N-[(1S,2S)-2-[[[[(1R,2R)-2-(Dimethylamino)cyclohexyl]amino]thioxomethyl]amino]-1,2-diphenylethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide

Benzenesulfonamide, N-[(1S,2S)-2-[[[[(1R,2R)-2-(dimethylamino)cyclohexyl]amino]thioxomethyl]amino]-1,2-diphenylethyl]-3,5-bis(trifluoromethyl)-
Ref: IN-DA001K8A
10mg | 119.00 € | ||
50mg | 142.00 € | ||
100mg | 167.00 € | ||
250mg | 316.00 € |

N-[(1S,2S)-2-[[[[(1R,2R)-2-(Dimethylamino)cyclohexyl]amino]thioxomethyl]amino]-1,2-diphenylethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide
- Sulphur (S) Compounds
- Tertiary Amines
- Fluorinated Compounds
- Ciclohexanes
- See more categories
- Others
Ref: 10-F611245
50mg | 115.00 € | ||
100mg | 222.00 € |

N-[(1S,2S)-2-[[[[(1R,2R)-2-(Dimethylamino)cyclohexyl]amino]thioxomethyl]amino]-1,2-diphenylethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide, 95%, (99% ee)
Ref: 08-07-6359
50mg | 213.00 € |

N-[(1S,2S)-2-[[[[(1R,2R)-2-(Dimethylamino)cyclohexyl]amino]thioxomethyl]amino]-1,2-diphenylethyl]-3,5-bis(trifluoromethyl)benzenesul fonamide
Ref: 3D-YHC60806
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |