CAS 144864-27-7
:3-(1-Pyrrolidinyl)-4-pyridinamine
Description:
3-(1-Pyrrolidinyl)-4-pyridinamine, with the CAS number 144864-27-7, is a chemical compound characterized by its unique structure, which includes a pyridine ring and a pyrrolidine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. It is often studied for its potential biological activities, particularly in medicinal chemistry, where modifications to the pyridine and pyrrolidine components can lead to compounds with enhanced pharmacological properties. The presence of the pyrrolidine ring may contribute to its conformational flexibility, impacting its interaction with biological targets. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for structural elucidation. Overall, 3-(1-Pyrrolidinyl)-4-pyridinamine represents a class of compounds that may have applications in drug development and other areas of chemical research.
Formula:C9H13N3
InChI:InChI=1S/C9H13N3/c10-8-3-4-11-7-9(8)12-5-1-2-6-12/h3-4,7H,1-2,5-6H2,(H2,10,11)
InChI key:InChIKey=CWJFTAFPORGNIN-UHFFFAOYSA-N
SMILES:NC=1C(N2CCCC2)=CN=CC1
Synonyms:- 3-(1-Pyrrolidinyl)-4-pyridinamine
- 3-(Pyrrolidin-1-yl)pyridin-4-amine
- 4-Pyridinamine, 3-(1-pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
