
CAS 1448724-09-1
:trans-N1-[7-(2-Methyl-2H-tetrazol-5-yl)-2-(phenylmethyl)-9H-pyrimido[4,5-b]indol-4-yl]-1,4-cyclohexanediamine
Description:
Trans-N1-[7-(2-Methyl-2H-tetrazol-5-yl)-2-(phenylmethyl)-9H-pyrimido[4,5-b]indol-4-yl]-1,4-cyclohexanediamine is a complex organic compound characterized by its unique structural features, including a pyrimidoindole core and a cyclohexanediamine moiety. This compound exhibits potential biological activity, often explored in medicinal chemistry for its possible therapeutic applications. The presence of the tetrazole ring contributes to its pharmacological properties, as tetrazoles are known for their ability to mimic carboxylic acids and can enhance solubility and bioavailability. The phenylmethyl group may influence the compound's interaction with biological targets, potentially affecting its efficacy and selectivity. Additionally, the trans configuration of the cyclohexanediamine unit may impact the compound's conformational stability and overall reactivity. While specific physical and chemical properties such as solubility, melting point, and spectral characteristics are not detailed here, they are essential for understanding the compound's behavior in various environments and its potential applications in drug development.
Formula:C25H27N9
InChI:InChI=1/C25H27N9/c1-34-32-23(31-33-34)16-7-12-19-20(14-16)28-25-22(19)24(27-18-10-8-17(26)9-11-18)29-21(30-25)13-15-5-3-2-4-6-15/h2-7,12,14,17-18H,8-11,13,26H2,1H3,(H2,27,28,29,30)/t17-,18-
InChI key:InChIKey=AZXXGVPWWKWGAE-IYARVYRRNA-N
SMILES:N(C1=C2C=3C(NC2=NC(CC4=CC=CC=C4)=N1)=CC(=CC3)C=5N=NN(C)N5)[C@H]6CC[C@H](N)CC6
Synonyms:- UM 171
- trans-N1-[7-(2-Methyl-2H-tetrazol-5-yl)-2-(phenylmethyl)-9H-pyrimido[4,5-b]indol-4-yl]-1,4-cyclohexanediamine
- 1,4-Cyclohexanediamine, N1-[7-(2-methyl-2H-tetrazol-5-yl)-2-(phenylmethyl)-9H-pyrimido[4,5-b]indol-4-yl]-, trans-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
UM171
CAS:<p>UM171 is a small-molecule compound, which is derived from synthetic chemical processes with properties that enable the expansion of human hematopoietic stem cells (HSCs) in vitro. It acts by targeting and modulating specific cellular pathways to enhance the self-renewal and proliferation of HSCs without inducing differentiation.<br><br>The primary application of UM171 lies in the field of regenerative medicine and transplantation. By facilitating the expansion of HSCs, UM171 holds significant potential in improving the outcomes of bone marrow and cord blood transplants. This is particularly relevant in contexts where donor cell availability is limited or where augmenting the engraftment potential of HSCs is critical. The ability to expand HSCs ex vivo opens avenues for improved treatment of hematological disorders, potentially allowing for more effective and accessible transplant therapies. Researchers are exploring its utility in diverse experimental setups, aiming to translate this compound's capabilities into clinical settings to enhance patient outcomes in hematopoietic recovery and therapy.</p>Formula:C25H27N9Purity:Min. 95%Color and Shape:PowderMolecular weight:453.54 g/mol


