
CAS 1448724-09-1
:trans-N1-[7-(2-Methyl-2H-tetrazol-5-yl)-2-(phenylmethyl)-9H-pyrimido[4,5-b]indol-4-yl]-1,4-cyclohexanediamine
Description:
Trans-N1-[7-(2-Methyl-2H-tetrazol-5-yl)-2-(phenylmethyl)-9H-pyrimido[4,5-b]indol-4-yl]-1,4-cyclohexanediamine is a complex organic compound characterized by its unique structural features, including a pyrimidoindole core and a cyclohexanediamine moiety. This compound exhibits potential biological activity, often explored in medicinal chemistry for its possible therapeutic applications. The presence of the tetrazole ring contributes to its pharmacological properties, as tetrazoles are known for their ability to mimic carboxylic acids and can enhance solubility and bioavailability. The phenylmethyl group may influence the compound's interaction with biological targets, potentially affecting its efficacy and selectivity. Additionally, the trans configuration of the cyclohexanediamine unit may impact the compound's conformational stability and overall reactivity. While specific physical and chemical properties such as solubility, melting point, and spectral characteristics are not detailed here, they are essential for understanding the compound's behavior in various environments and its potential applications in drug development.
Formula:C25H27N9
InChI:InChI=1/C25H27N9/c1-34-32-23(31-33-34)16-7-12-19-20(14-16)28-25-22(19)24(27-18-10-8-17(26)9-11-18)29-21(30-25)13-15-5-3-2-4-6-15/h2-7,12,14,17-18H,8-11,13,26H2,1H3,(H2,27,28,29,30)/t17-,18-
InChI key:InChIKey=AZXXGVPWWKWGAE-IYARVYRRNA-N
SMILES:N(C1=C2C=3C(NC2=NC(CC4=CC=CC=C4)=N1)=CC(=CC3)C=5N=NN(C)N5)[C@H]6CC[C@H](N)CC6
Synonyms:- UM 171
- trans-N1-[7-(2-Methyl-2H-tetrazol-5-yl)-2-(phenylmethyl)-9H-pyrimido[4,5-b]indol-4-yl]-1,4-cyclohexanediamine
- 1,4-Cyclohexanediamine, N1-[7-(2-methyl-2H-tetrazol-5-yl)-2-(phenylmethyl)-9H-pyrimido[4,5-b]indol-4-yl]-, trans-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery

