CAS 1448850-68-7

4-Pyrimidinamine, N-(3R)-3-pyrrolidinyl-, hydrochloride (1:2)

Description:

4-Pyrimidinamine, N-(3R)-3-pyrrolidinyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine and pyrrolidine moieties, which contribute to its biological activity. The presence of the pyrimidinamine structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The hydrochloride salt form indicates enhanced solubility in aqueous solutions, which is beneficial for drug formulation and delivery. This compound may exhibit properties such as being a potential inhibitor or modulator of specific enzymes or receptors, making it of interest in therapeutic research. Its stereochemistry, indicated by the (3R) designation, suggests that the compound may have specific interactions with biological targets, influencing its efficacy and safety profile. As with many compounds in this class, further studies would be necessary to elucidate its pharmacological properties, including its mechanism of action, bioavailability, and potential side effects. Overall, 4-Pyrimidinamine, N-(3R)-3-pyrrolidinyl-, hydrochloride (1:2) represents a promising candidate for further investigation in the field of medicinal chemistry.

Formula: C₈H₁₂N₄·2ClH

InChI: InChI=1S/C8H12N4.2ClH/c1-3-9-5-7(1)12-8-2-4-10-6-11-8;;/h2,4,6-7,9H,1,3,5H2,(H,10,11,12);2*1H/t7-;;/m1../s1

InChI key: InChIKey=XSPXVKUSJFPCNR-XCUBXKJBSA-N

SMILES: N(C=1C=CN=CN1)[C@@H]2CCNC2.Cl

Synonyms:

• 4-Pyrimidinamine, N-(3R)-3-pyrrolidinyl-, hydrochloride (1:2)

N-[(3R)-Pyrrolidin-3-yl]pyrimidin-4-amine dihydrochloride

CAS: 1448850-68-7

N-[(3R)-Pyrrolidin-3-yl]pyrimidin-4-amine dihydrochloride

Purity: ≥95%

Molecular weight: 237.13g/mol

Ref: 54-OR306243

N-[(3R)-Pyrrolidin-3-yl]pyrimidin-4-amine dihydrochloride

CAS: 1448850-68-7

Formula: C₈H₁₄Cl₂N₄

Color and Shape: Solid

Molecular weight: 237.13

Ref: 10-F476036