CAS 1448854-73-6

4-Pyrimidinamine, N-4-piperidinyl-, hydrochloride (1:2)

Description:

4-Pyrimidinamine, N-4-piperidinyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine and piperidine moieties, which contribute to its biological activity. This substance typically appears as a white to off-white crystalline solid and is soluble in water, indicating its potential for biological interactions. The hydrochloride form suggests that it is a salt, which often enhances solubility and stability. The presence of the piperidine ring may impart specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its molecular structure allows for potential interactions with biological receptors or enzymes, which can be explored in drug design. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, 4-Pyrimidinamine, N-4-piperidinyl-, hydrochloride (1:2) represents a compound with potential applications in research and therapeutic contexts, warranting further investigation into its properties and effects.

Formula: C₉H₁₄N₄·2ClH

InChI: InChI=1S/C9H14N4.2ClH/c1-4-10-5-2-8(1)13-9-3-6-11-7-12-9;;/h3,6-8,10H,1-2,4-5H2,(H,11,12,13);2*1H

InChI key: InChIKey=OEHKVTLUIZGSLA-UHFFFAOYSA-N

SMILES: N(C1CCNCC1)C=2C=CN=CN2.Cl

Synonyms:

• 4-Pyrimidinamine, N-4-piperidinyl-, hydrochloride (1:2)

N-(Piperidin-4-yl)pyrimidin-4-amine dihydrochloride

CAS: 1448854-73-6

N-(Piperidin-4-yl)pyrimidin-4-amine dihydrochloride

Purity: ≥95%

Molecular weight: 251.16g/mol

Ref: 54-OR306237

N-(Piperidin-4-yl)pyrimidin-4-amine dihydrochloride

CAS: 1448854-73-6

Formula: C₉H₁₆Cl₂N₄

Molecular weight: 251.16

Ref: 10-F097426