CAS 1448854-99-6

2-Pyrazinamine, N-4-piperidinyl-, hydrochloride (1:2)

Description:

2-Pyrazinamine, N-4-piperidinyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrazinamine core, which features a pyrazine ring substituted with an amino group. The presence of the piperidine moiety introduces a cyclic amine structure, enhancing its potential for biological activity. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in drug synthesis or having specific pharmacological effects, although detailed biological activity would depend on further studies. The molecular structure suggests it may interact with various biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Its CAS number, 1448854-99-6, allows for precise identification and reference in chemical databases and literature.

Formula: C₉H₁₄N₄·2ClH

InChI: InChI=1S/C9H14N4.2ClH/c1-3-10-4-2-8(1)13-9-7-11-5-6-12-9;;/h5-8,10H,1-4H2,(H,12,13);2*1H

InChI key: InChIKey=CGBINJJGVHCAAH-UHFFFAOYSA-N

SMILES: N(C1CCNCC1)C=2C=NC=CN2.Cl

Synonyms:

• 2-Pyrazinamine, N-4-piperidinyl-, hydrochloride (1:2)

N-(Piperidin-4-yl)pyrazin-2-amine dihydrochloride

CAS: 1448854-99-6

N-(Piperidin-4-yl)pyrazin-2-amine dihydrochloride

Purity: ≥95%

Molecular weight: 251.16g/mol

Ref: 54-OR306239

N-(Piperidin-4-yl)pyrazin-2-amine dihydrochloride

CAS: 1448854-99-6

Formula: C₉H₁₆Cl₂N₄

Molecular weight: 251.16

Ref: 10-F097423