CAS 14490-19-8

1,4-DICHLOROPYRIDO[4,3-D]PYRIDAZINE

Description:

1,4-Dichloropyrido[4,3-d]pyridazine is a heterocyclic compound characterized by its fused pyridine and pyridazine rings, with two chlorine substituents at the 1 and 4 positions. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure contributes to its potential reactivity, particularly in electrophilic substitution reactions due to the presence of the electron-withdrawing chlorine atoms. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility as a building block in the synthesis of more complex molecules. Additionally, its unique structural features may impart specific electronic properties, making it suitable for applications in organic electronics or as a ligand in coordination chemistry. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and disposal methods are essential to mitigate risks associated with its use.

Formula: C₇H₃Cl₂N₃

InChI: InChI=1/C7H3Cl2N3/c8-6-4-1-2-10-3-5(4)7(9)12-11-6/h1-3H

SMILES: c1cncc2c1c(Cl)nnc2Cl

Synonyms:

• 1,4-Dichloropyrido[3,4-d]pyridazine
• Pyrido[3,4-d]pyridazine, 1,4-dichloro-

Pyrido[3,4-d]pyridazine, 1,4-dichloro-

CAS: 14490-19-8

Formula: C₇H₃Cl₂N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 200.0248

Ref: IN-DA001KB9

1,4-Dichloropyrido[3,4-d]pyridazine

CAS: 14490-19-8

1,4-Dichloropyrido[3,4-d]pyridazine

Formula: C₇H₃Cl₂N₃

Purity: 97%

Color and Shape: pale yellow solid

Molecular weight: 200.02g/mol

Ref: 54-OR52405

1,4-Dichloropyrido[4,3-d]pyridazine

CAS: 14490-19-8

Formula: C₇H₃Cl₂N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 200.02

Ref: 10-F093262