
CAS 14491-59-9
:Credazine
Description:
Credazine, with the CAS number 14491-59-9, is a chemical compound that belongs to the class of phenothiazines, which are known for their diverse pharmacological properties. It is primarily recognized for its use as an antipsychotic medication, exhibiting effects that can help manage symptoms of various psychiatric disorders. The structure of Credazine features a tricyclic framework, which is characteristic of many phenothiazine derivatives, contributing to its ability to interact with neurotransmitter systems in the brain, particularly dopamine and serotonin receptors. This interaction is crucial for its therapeutic effects, as it helps to stabilize mood and reduce psychotic symptoms. Additionally, Credazine may possess sedative properties, making it useful in certain clinical settings. However, like many medications, it can also have side effects, including sedation, weight gain, and potential extrapyramidal symptoms. As with any pharmaceutical compound, its use should be carefully monitored by healthcare professionals to ensure safety and efficacy in treatment.
Formula:C11H10N2O
InChI:InChI=1S/C11H10N2O/c1-9-5-2-3-6-10(9)14-11-7-4-8-12-13-11/h2-8H,1H3
InChI key:InChIKey=DNPSYFHJYIRREW-UHFFFAOYSA-N
SMILES:O(C1=C(C)C=CC=C1)C2=CC=CN=N2
Synonyms:- Pyridazine, 3-(2-methylphenoxy)-
- 3-(2-Methylphenoxy)pyridazine
- 3-(2′-Methylphenoxy)pyridazine
- NIA 20439
- Pyridazine, 3-(o-tolyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Credazine
CAS:Credazine is a bio-active chemical. Detailed information has not been published.Formula:C11H10N2OColor and Shape:SolidMolecular weight:186.21
