CymitQuimica logo

CAS 1449117-28-5

:

[1,3′-Biazetidin]-3-ol, hydrochloride (1:1)

Description:
[1,3′-Biazetidin]-3-ol, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which includes two azetidine rings. This compound features a hydroxyl group (-OH) at the 3-position of one of the azetidine rings, contributing to its potential reactivity and solubility in polar solvents. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. The presence of the hydrochloride indicates that the compound can form ionic interactions, which may enhance its bioavailability in pharmaceutical applications. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The compound's properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. As with many chemical compounds, safety data and handling precautions should be observed, particularly due to the potential biological activity associated with its structure.
Formula:C6H12N2O·ClH
InChI:InChI=1S/C6H12N2O.ClH/c9-6-3-8(4-6)5-1-7-2-5;/h5-7,9H,1-4H2;1H
InChI key:InChIKey=ARVXNRZKWYNGCF-UHFFFAOYSA-N
SMILES:OC1CN(C1)C2CNC2.Cl
Synonyms:
  • [1,3′-Biazetidin]-3-ol, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.