CAS 1449117-68-3

N-[2-Cyano-5-(trifluoromethyl)-3-pyridinyl]glycine ethyl ester

Description:

N-[2-Cyano-5-(trifluoromethyl)-3-pyridinyl]glycine ethyl ester, with the CAS number 1449117-68-3, is a chemical compound that features a pyridine ring substituted with a cyano group and a trifluoromethyl group, along with an ethyl ester of glycine. This compound is characterized by its unique structural components, which contribute to its potential biological activity and applications in medicinal chemistry. The presence of the trifluoromethyl group often enhances lipophilicity and metabolic stability, while the cyano group can participate in various chemical reactions, making it a versatile building block in organic synthesis. The ethyl ester moiety can influence the solubility and bioavailability of the compound. Overall, this substance may exhibit interesting pharmacological properties, making it a candidate for further research in drug development and related fields. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₁H₁₀F₃N₃O₂

InChI: InChI=1S/C11H10F3N3O2/c1-2-19-10(18)6-17-8-3-7(11(12,13)14)5-16-9(8)4-15/h3,5,17H,2,6H2,1H3

InChI key: InChIKey=GZGRFQYAPUQDOI-UHFFFAOYSA-N

SMILES: N(CC(OCC)=O)C1=C(C#N)N=CC(C(F)(F)F)=C1

Synonyms:

• N-[2-Cyano-5-(trifluoromethyl)-3-pyridinyl]glycine ethyl ester
• Glycine, N-[2-cyano-5-(trifluoromethyl)-3-pyridinyl]-, ethyl ester

Ethyl 2-[[2-cyano-5-(trifluoromethyl)pyridin-3-yl]amino]acetate

CAS: 1449117-68-3

Ethyl 2-[[2-cyano-5-(trifluoromethyl)pyridin-3-yl]amino]acetate

Purity: 95%

Molecular weight: 273.21g/mol

Ref: 54-PC401039