CAS 1449117-70-7

Quinoline, 8-(3-azetidinyloxy)-, hydrochloride (1:2)

Description:

Quinoline, 8-(3-azetidinyloxy)-, hydrochloride (1:2) is a chemical compound characterized by its quinoline backbone, which is a bicyclic aromatic structure known for its heterocyclic properties. The presence of the azetidinyloxy group indicates that it contains a four-membered nitrogen-containing ring, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which could lead to therapeutic effects. The CAS number 1449117-70-7 uniquely identifies this compound in chemical databases, facilitating research and regulatory processes. Safety and handling precautions should be observed, as with all chemical substances, due to the potential for toxicity or reactivity. Further studies would be necessary to fully elucidate its properties, mechanisms of action, and potential applications in drug development.

Formula: C₁₂H₁₂N₂O·2ClH

InChI: InChI=1S/C12H12N2O.2ClH/c1-3-9-4-2-6-14-12(9)11(5-1)15-10-7-13-8-10;;/h1-6,10,13H,7-8H2;2*1H

InChI key: InChIKey=LMGJRPLMOJQHNF-UHFFFAOYSA-N

SMILES: O(C=1C2=C(C=CC1)C=CC=N2)C3CNC3.Cl

Synonyms:

• 8-(Azetidin-3-yloxy)quinoline dihydrochloride
• Quinoline, 8-(3-azetidinyloxy)-, hydrochloride (1:2)

8-(azetidin-3-yloxy)quinoline dihydrochloride

CAS: 1449117-70-7

Formula: C₁₂H₁₄Cl₂N₂O

Purity: 95.0%

Molecular weight: 273.16

Ref: 10-F512047