CymitQuimica logo

CAS 1449132-55-1

:

B-[3-Fluoro-5-[[(2-fluoro-5-nitrophenyl)amino]carbonyl]phenyl]boronic acid

Description:
B-[3-Fluoro-5-[[(2-fluoro-5-nitrophenyl)amino]carbonyl]phenyl]boronic acid is a boronic acid derivative characterized by its complex molecular structure, which includes a boron atom bonded to a phenyl ring substituted with both fluoro and nitro groups. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of fluorine and nitro groups can enhance its reactivity and influence its electronic properties, potentially affecting its interactions with biological targets. Additionally, boronic acids are known for their role in the development of pharmaceuticals, particularly in the context of cancer treatment and as inhibitors of certain enzymes. The specific arrangement of substituents in this compound may also impart unique characteristics, such as solubility in organic solvents and specific binding affinities, which are critical for its application in research and industry.
Formula:C13H9BF2N2O5
InChI:InChI=1S/C13H9BF2N2O5/c15-9-4-7(3-8(5-9)14(20)21)13(19)17-12-6-10(18(22)23)1-2-11(12)16/h1-6,20-21H,(H,17,19)
InChI key:InChIKey=WMVABRNSEZIZGB-UHFFFAOYSA-N
SMILES:C(NC1=CC(N(=O)=O)=CC=C1F)(=O)C2=CC(B(O)O)=CC(F)=C2
Synonyms:
  • B-[3-Fluoro-5-[[(2-fluoro-5-nitrophenyl)amino]carbonyl]phenyl]boronic acid
  • Boronic acid, B-[3-fluoro-5-[[(2-fluoro-5-nitrophenyl)amino]carbonyl]phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.