CAS 14492-15-0
:H-Met-Phe-Gly-OH
Description:
H-Met-Phe-Gly-OH, also known as a peptide, is a small molecule composed of three amino acids: methionine (Met), phenylalanine (Phe), and glycine (Gly), with a carboxylic acid group at one end. This compound is characterized by its specific sequence of amino acids, which contributes to its unique properties and potential biological activities. Peptides like H-Met-Phe-Gly-OH can exhibit various functions, including acting as signaling molecules, hormones, or components of larger proteins. The presence of methionine, an essential amino acid, suggests potential roles in protein synthesis and metabolism. Phenylalanine, known for its aromatic side chain, may contribute to the compound's hydrophobic characteristics, while glycine, the simplest amino acid, can provide flexibility in the peptide's structure. The overall structure and properties of H-Met-Phe-Gly-OH can influence its solubility, stability, and interactions with biological systems, making it of interest in fields such as biochemistry, pharmacology, and biotechnology.
Formula:C16H23N3O4S
InChI:InChI=1/C16H23N3O4S/c1-24-8-7-12(17)15(22)19-13(16(23)18-10-14(20)21)9-11-5-3-2-4-6-11/h2-6,12-13H,7-10,17H2,1H3,(H,18,23)(H,19,22)(H,20,21)
SMILES:CSCCC(C(=NC(Cc1ccccc1)C(=NCC(=O)O)O)O)N
Synonyms:- L-Methionyl-L-Phenylalanyl Glycine
- L-Met-Phe-Gly
- Methionylphenylalanylglycine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
H-Met-Phe-Gly-OH
CAS:H-Met-Phe-Gly-OH is a hydrophobic amino acid. It has been shown to be present in human proteins, and it has been used as a marker for determining the sequence of amino acids in peptides. H-Met-Phe-Gly-OH is an acidic tripeptide that can be analysed using reversed phase high performance liquid chromatography (RPHPLC). This tripeptide is found in the peptide transporter, which transports amino acids across cellular membranes. The structural studies of H-Met-Phe-Gly-OH have revealed that this tripeptide has an alpha helix conformation, with two hydrogen bonds from the backbone amides to the backbone carbonyl groups.Formula:C16H23N3O4SPurity:Min. 95%Molecular weight:353.44 g/mol

