CymitQuimica logo

CAS 144951-90-6

:

1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonamide

Description:
1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonamide is a fluorinated organic compound characterized by its unique structure, which includes multiple fluorine atoms and a sulfonamide functional group. This compound is notable for its high thermal and chemical stability, making it suitable for various applications in the fields of materials science and pharmaceuticals. The presence of fluorine atoms contributes to its hydrophobic properties, enhancing its resistance to solvents and degradation. Additionally, the sulfonamide group can impart biological activity, potentially making it relevant in medicinal chemistry. Its synthesis typically involves complex organic reactions that require careful handling due to the reactivity of fluorinated compounds. The compound's physical properties, such as melting point, boiling point, and solubility, are influenced by its fluorinated nature and the presence of the sulfonamide group. Overall, 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonamide exemplifies the unique characteristics of fluorinated compounds, including stability, reactivity, and potential utility in various applications.
Formula:C4H3F8NO3S
InChI:InChI=1/C4H3F8NO3S/c5-1(6)2(7,8)16-3(9,10)4(11,12)17(13,14)15/h1H,(H2,13,14,15)
SMILES:C(C(F)(F)OC(C(F)(F)S(=O)(=O)N)(F)F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.