CymitQuimica logo

CAS 1449581-03-6

:

7-Fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole

Description:
7-Fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole is a chemical compound characterized by its indole core, which is a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 7-position and a methyl group at the 5-position contributes to its unique reactivity and potential biological activity. The compound also features a boron-containing moiety, specifically a tetramethyl-1,3,2-dioxaborolane, which is known for its applications in organic synthesis and as a reagent in various chemical reactions, including cross-coupling reactions. This structure suggests potential uses in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's properties, such as solubility, stability, and reactivity, can be influenced by the functional groups present, making it a subject of interest for further research in both synthetic and medicinal chemistry. Its CAS number, 1449581-03-6, allows for easy identification and reference in chemical databases.
Formula:C15H19BFNO2
InChI:InChI=1S/C15H19BFNO2/c1-9-8-11(17)13-10(6-7-18-13)12(9)16-19-14(2,3)15(4,5)20-16/h6-8,18H,1-5H3
InChI key:InChIKey=IZWFOTDZJSENBJ-UHFFFAOYSA-N
SMILES:CC=1C(=C2C(=C(F)C1)NC=C2)B3OC(C)(C)C(C)(C)O3
Synonyms:
  • 1H-Indole, 7-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 7-Fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.