CAS 1449598-76-8

Pyrazolo[1,5-a]pyrazine-2-carboxylic acid, 4,6-dimethyl-, ethyl ester

Description:

Pyrazolo[1,5-a]pyrazine-2-carboxylic acid, 4,6-dimethyl-, ethyl ester is a chemical compound characterized by its unique pyrazolo[1,5-a]pyrazine core structure, which consists of two fused pyrazole rings. This compound features a carboxylic acid functional group and an ethyl ester moiety, contributing to its solubility and reactivity. The presence of methyl groups at the 4 and 6 positions of the pyrazine ring enhances its lipophilicity and may influence its biological activity. Typically, compounds of this class are studied for their potential pharmacological properties, including anti-inflammatory and antimicrobial activities. The molecular structure allows for various interactions with biological targets, making it a subject of interest in medicinal chemistry. Additionally, the compound's stability, melting point, and solubility characteristics are essential for its application in research and development. As with many organic compounds, safety data and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₁₃N₃O₂

InChI: InChI=1S/C11H13N3O2/c1-4-16-11(15)9-5-10-8(3)12-7(2)6-14(10)13-9/h5-6H,4H2,1-3H3

InChI key: InChIKey=PWHWSSBNPRHDJB-UHFFFAOYSA-N

SMILES: CC=1C=2N(N=C(C(OCC)=O)C2)C=C(C)N1

Synonyms:

• Ethyl4,6-dimethylpyrazolo[1,5-a]pyrazine-2-carboxylate
• Pyrazolo[1,5-a]pyrazine-2-carboxylic acid, 4,6-dimethyl-, ethyl ester

Ethyl 4,6-dimethylpyrazolo[1,5-a]pyrazine-2-carboxylate

CAS: 1449598-76-8

Versatile small molecule scaffold

Formula: C₁₁H₁₃N₃O₂

Purity: Min. 95%

Molecular weight: 219.24 g/mol

Ref: 3D-ZHC59876