CAS 14496-35-6

N,N-Dimethyl-5-methylfurfurylamine

Description:

N,N-Dimethyl-5-methylfurfurylamine is an organic compound characterized by its amine functional group and a furan ring structure. It features a dimethylamino group attached to a 5-methylfurfuryl moiety, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits moderate polarity due to the presence of the amine group. N,N-Dimethyl-5-methylfurfurylamine is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, owing to its reactivity and ability to participate in various chemical reactions, such as nucleophilic substitutions. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data indicates that, like many amines, it should be handled with care due to potential irritant properties. Overall, its unique structure and reactivity profile make it a compound of interest in both industrial and research settings.

Formula: C₈H₁₃NO

InChI: InChI=1/C8H13NO/c1-7-4-5-8(10-7)6-9(2)3/h4-5H,6H2,1-3H3

SMILES: Cc1ccc(CN(C)C)o1

N,N,5-Trimethylfurfurylamine

CAS: 14496-35-6

Formula: C₈H₁₃NO

Purity: >98.0%(GC)(T)

Color and Shape: Light yellow to Amber to Dark green clear liquid

Molecular weight: 139.20

Ref: 3B-T2508

2-Furanmethanamine, N,N,5-trimethyl-

CAS: 14496-35-6

Formula: C₈H₁₃NO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 139.1949

Ref: IN-DA001KE7

N,N-Dimethyl-1-(5-Methylfuran-2-Yl)Methanamine

CAS: 14496-35-6

N,N-Dimethyl-1-(5-Methylfuran-2-Yl)Methanamine

Purity: 98%

Molecular weight: 139.19g/mol

Ref: 54-OR1014130

N,N-Dimethyl-1-(5-methylfuran-2-yl)methanamine

CAS: 14496-35-6

Purity: 97%

Molecular weight: 139.197998

Ref: 10-F868967