CAS 144967-77-1
:CIS-Butanoic Acid 2-Butene-1,4-Diylester
Description:
Cis-Butanoic Acid 2-Butene-1,4-Diylester, identified by its CAS number 144967-77-1, is an organic compound characterized by its ester functional groups derived from butanoic acid and 2-butene. This compound features a cis configuration, indicating that the substituents on the double bond are oriented on the same side, which can influence its physical properties and reactivity. Typically, esters like this one exhibit moderate polarity, which affects their solubility in various solvents, and they often have distinctive odors. The presence of the butanoic acid moiety contributes to its potential applications in flavoring and fragrance industries. Additionally, the structure suggests potential reactivity in polymerization processes or as intermediates in organic synthesis. The compound's stability, boiling point, and melting point would depend on its molecular weight and the specific arrangement of its atoms. Overall, cis-Butanoic Acid 2-Butene-1,4-Diylester is a versatile compound with potential applications in various chemical industries.
Formula:C12H20O4
InChI:InChI=1/C12H20O4/c1-3-7-11(13)15-9-5-6-10-16-12(14)8-4-2/h5-6H,3-4,7-10H2,1-2H3/b6-5-
SMILES:CCCC(=O)OC/C=C\COC(=O)CCC
Synonyms:- cis-Butanoic acid 2-butene-1,4-diyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
