CAS 1450-80-2

4-Bromopentanoic acid

Description:

4-Bromopentanoic acid is a carboxylic acid characterized by the presence of a bromine atom at the fourth carbon position of a five-carbon alkane chain. Its molecular formula is C5H9BrO2, indicating it contains five carbon atoms, nine hydrogen atoms, one bromine atom, and two oxygen atoms. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its moderate solubility in water, which is influenced by the carboxylic acid functional group, while its hydrophobic alkyl chain contributes to its solubility in organic solvents. 4-Bromopentanoic acid can participate in various chemical reactions, including esterification and nucleophilic substitution, making it useful in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, it may exhibit biological activity, which can be of interest in medicinal chemistry. Proper handling and storage are essential due to its potential reactivity and the presence of bromine, which can be hazardous.

Formula: C₅H₉BrO₂

InChI: InChI=1S/C5H9BrO2/c1-4(6)2-3-5(7)8/h4H,2-3H2,1H3,(H,7,8)

InChI key: InChIKey=XILQGXZARXHSEI-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C(Br)C

Synonyms:

• Valeric acid, γ-bromo-
• Pentanoic acid, 4-bromo-
• 4-Bromopentanoic acid
• Valeric acid, 4-bromo-

4-Bromopentanoic Acid

Controlled Product

CAS: 1450-80-2

Formula: C₅H₉BrO₂

Color and Shape: Neat

Molecular weight: 181.028

Ref: TR-B803860

4-Bromopentanoic acid

CAS: 1450-80-2

Versatile small molecule scaffold

Formula: C₅H₉BrO₂

Purity: Min. 95%

Molecular weight: 181.03 g/mol

Ref: 3D-BAA45080