CAS 14501-66-7

1,4-DIMETHYL-3-FORMYLCARBAZOLE

Description:

1,4-Dimethyl-3-formylcarbazole is an organic compound belonging to the carbazole family, characterized by its fused ring structure that includes a dibenzopyrrole moiety. This compound features two methyl groups at the 1 and 4 positions and a formyl group at the 3 position of the carbazole ring. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and specific conditions. The presence of the formyl group introduces reactivity, making it a potential candidate for various chemical reactions, including condensation and oxidation. 1,4-Dimethyl-3-formylcarbazole is of interest in organic synthesis and materials science, particularly in the development of organic semiconductors and dyes. Its properties, such as solubility and melting point, can vary based on the solvent and environmental conditions. Additionally, the compound may exhibit fluorescence, which can be harnessed in applications such as sensors and light-emitting devices. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₅H₁₃NO

InChI: InChI=1/C15H13NO/c1-9-7-11(8-17)10(2)14-12-5-3-4-6-13(12)16-15(9)14/h3-8,16H,1-2H3

SMILES: Cc1cc(C=O)c(C)c2c3ccccc3[nH]c12

Synonyms:

• 1,4-Dimethyl-9H-carbazole-3-carbaldehyde
• Nsc 98667

1,4-Dimethyl-9H-carbazole-3-carbaldehyde

CAS: 14501-66-7

Formula: C₁₅H₁₃NO

Color and Shape: Solid

Molecular weight: 223.2698

Ref: IN-DA001KGU

Ellipticine Impurity 1

CAS: 14501-66-7

Formula: C₁₅H₁₃NO

Molecular weight: 223.28

Ref: 4Z-E-200003

1,4-Dimethyl-3-formylcarbazole

CAS: 14501-66-7

1,4-Dimethyl-3-formylcarbazole is a synthetic compound that inhibits the growth of cancer cells by inducing apoptosis. It also has antibacterial activity against bacteria such as Staphylococcus and Bacillus subtilis. 1,4-Dimethyl-3-formylcarbazole is a hexacyclic molecule which inhibits bacterial cell growth through the biosynthesis of adriamycin and tetrazolium dye. In addition, 1,4-Dimethyl-3-formylcarbazole may have antitumor properties because it induces apoptosis in MDA-MB 231 breast cancer cells.

Formula: C₁₅H₁₃NO

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 223.27 g/mol

Ref: 3D-FD67286