CAS 145026-88-6
:Flucarbazone
Description:
Flucarbazone is a chemical compound primarily used as a herbicide in agricultural applications, particularly for controlling certain grass and broadleaf weeds in crops. It belongs to the class of compounds known as sulfonylureas, which function by inhibiting specific enzymes involved in the biosynthesis of amino acids, ultimately leading to plant growth inhibition and death. Flucarbazone is characterized by its selective action, allowing it to target undesirable plants while minimizing harm to crops. The compound is typically applied in pre-emergent or post-emergent stages, depending on the target weed species and crop type. Its effectiveness is influenced by environmental factors such as soil type, moisture, and temperature. Additionally, Flucarbazone has a relatively low toxicity profile for humans and non-target organisms, making it a preferred choice in integrated pest management strategies. However, like all herbicides, it is essential to follow recommended application guidelines to mitigate potential environmental impacts and resistance development in weed populations.
Formula:C12H11F3N4O6S
InChI:InChI=1S/C12H11F3N4O6S/c1-18-10(24-2)16-19(11(18)21)9(20)17-26(22,23)8-6-4-3-5-7(8)25-12(13,14)15/h3-6H,1-2H3,(H,17,20)
InChI key:InChIKey=GINFBXXYGUODAT-UHFFFAOYSA-N
SMILES:S(NC(=O)N1N=C(OC)N(C)C1=O)(=O)(=O)C2=C(OC(F)(F)F)C=CC=C2
Synonyms:- 1H-1,2,4-Triazole-1-carboxamide, 4,5-dihydro-3-methoxy-4-methyl-5-oxo-N-((2-(trifluoromethoxy)phenyl)sulfonyl)-
- 3-methoxy-4-methyl-5-oxo-N-[2-(trifluoromethoxy)phenyl]sulfonyl-1,2,4-triazole-1-carboxamide
- 3-methoxy-4-methyl-5-oxo-N-{[2-(trifluoromethoxy)phenyl]sulfonyl}-4,5-dihydro-1H-1,2,4-triazole-1-carboxamide
- 4,5-Dihydro-3-methoxy-4-methyl-5-oxo-N-[[2-(trifluoromethoxy)phenyl]sulfonyl]-1H-1,2,4-triazole-1-carboxamide
- Everest 2.0
- Flucarbazone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
