CAS 145027-96-9

2,4-Dihydro-4-methyl-5-propoxy-3H-1,2,4-triazol-3-one

Description:

2,4-Dihydro-4-methyl-5-propoxy-3H-1,2,4-triazol-3-one is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance typically exhibits properties associated with triazoles, such as potential fungicidal or herbicidal activity, making it of interest in agricultural applications. The presence of the propoxy group enhances its solubility and may influence its biological activity. The methyl group contributes to the compound's overall hydrophobic character, which can affect its interaction with biological membranes. Additionally, the compound's structure suggests it may participate in hydrogen bonding due to the presence of the carbonyl group, which can influence its reactivity and stability. As with many triazole derivatives, it may also exhibit a range of pharmacological properties, although specific biological activities would require further investigation. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards associated with its use.

Formula: C₆H₁₁N₃O₂

InChI: InChI=1S/C6H11N3O2/c1-3-4-11-6-8-7-5(10)9(6)2/h3-4H2,1-2H3,(H,7,10)

InChI key: InChIKey=HSOFIFZZCZLBFE-UHFFFAOYSA-N

SMILES: O(CCC)C=1N(C)C(=O)NN1

Synonyms:

• 3H-1,2,4-triazol-3-one, 2,4-dihydro-4-methyl-5-propoxy-
• 4-Methyl-5-propoxy-2,4-dihydro-3H-1,2,4-triazol-3-one
• 2,4-Dihydro-4-Methyl-5-Propoxy-3H-1,2,4-Triazol-3-One

3H-1,2,4-Triazol-3-one, 2,4-dihydro-4-methyl-5-propoxy-

CAS: 145027-96-9

Formula: C₆H₁₁N₃O₂

Purity: 98%

Molecular weight: 157.1704

Ref: IN-DA001KH8

2,4-Dihydro-4-methyl-5-propoxy-3H-1,2,4-triazol-3-one

CAS: 145027-96-9

2,4-Dihydro-4-methyl-5-propoxy-3H-1,2,4-triazol-3-one

Formula: C₆H₁₁N₃O₂

Purity: 98%

Color and Shape: white solid

Molecular weight: 157.17g/mol

Ref: 54-OR1010056

4-Methyl-3-propoxy-1H-1,2,4-triazol-5(4H)-one

CAS: 145027-96-9

Formula: C₆H₁₁N₃O₂

Purity: 98%+(LC-MS);RG

Molecular weight: 157.173

Ref: 10-F229286

4-Methyl-3-propoxy-1H-1,2,4-triazol-5(4H)-one

CAS: 145027-96-9

4-Methyl-3-propoxy-1H-1,2,4-triazol-5(4H)-one is a phenyl triazolinone herbicide that acts as an inhibitor of the plant enzyme acetohydroxy acid synthase. It also has surfactant properties and can be used as a sulfonylurea herbicide. This compound is used to control weeds in cereal crops and wheat. 4-Methyl-3-propoxy 1H1,2,4-triazol 5(4H) - one inhibits the growth of bacteria by binding to the 50S ribosomal subunit. It is also effective against some strains of Mycobacterium tuberculosis and Mycobacterium avium complex.

Formula: C₆H₁₁N₃O₂

Purity: Min. 95%

Molecular weight: 157.17 g/mol

Ref: 3D-VFA02796