CymitQuimica logo

CAS 145035-96-7

:

α-[7-Hydroxy-7-oxido-13-oxo-10-[(1-oxooctadecyl)oxy]-6,8,12-trioxa-3-aza-7-phosphatriacont-1-yl]-ω-hydroxypoly(oxy-1,2-ethanediyl)

Description:
The chemical substance known as α-[7-Hydroxy-7-oxido-13-oxo-10-[(1-oxooctadecyl)oxy]-6,8,12-trioxa-3-aza-7-phosphatriacont-1-yl]-ω-hydroxypoly(oxy-1,2-ethanediyl) with CAS number 145035-96-7 is a complex organic compound characterized by its unique structural features, including multiple functional groups such as hydroxyl, oxo, and ether linkages. This compound is part of a larger class of phospholipids or phosphonolipids, which are known for their roles in biological membranes and potential applications in drug delivery systems. Its structure suggests a high degree of hydrophilicity due to the presence of poly(oxy-1,2-ethanediyl) segments, which can enhance solubility in aqueous environments. Additionally, the long alkyl chain (1-oxooctadecyl) contributes to its amphiphilic nature, allowing it to interact with both hydrophilic and hydrophobic environments. The presence of phosphorus and nitrogen atoms indicates potential bioactivity, making it of interest in pharmaceutical and biochemical research. Overall, this compound's intricate structure and functional diversity position it as a significant candidate for various applications in chemistry and biochemistry.
Formula:(C2H4O)nC43H86NO9P
Synonyms:
  • Distearoylphosphatidylethanolamine-PEG
  • Poly(oxy-1,2-ethanediyl), α-[7-hydroxy-13-oxo-10-[(1-oxooctadecyl)oxy]-6,8,12-trioxa-3-aza-7-phosphatriacont-1-yl]-ω-hydroxy-, P-oxide
  • Poly(oxy-1,2-ethanediyl), α-[7-hydroxy-7-oxido-13-oxo-10-[(1-oxooctadecyl)oxy]-6,8,12-trioxa-3-aza-7-phosphatriacont-1-yl]-ω-hydroxy-
  • DSPE-PEG
  • α-[7-Hydroxy-7-oxido-13-oxo-10-[(1-oxooctadecyl)oxy]-6,8,12-trioxa-3-aza-7-phosphatriacont-1-yl]-ω-hydroxypoly(oxy-1,2-ethanediyl)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • DSPE-PEG

    CAS:
    <p>DSPE-PEG: a phospholipid-polymer for stable, efficient drug delivery with longer circulation.</p>
    Formula:C45H90NO10P
    Color and Shape:Solid
    Molecular weight:835.63024