CAS 145042-06-4
:scammonin VIII
Description:
Scammonin VIII is a chemical compound derived from the plant species *Convolvulus scammonia*, commonly known for its medicinal properties. It is classified as a glycoside, which means it consists of a sugar moiety attached to a non-sugar component, typically an aglycone. This compound is notable for its potential pharmacological activities, including anti-inflammatory and analgesic effects. Its structure features a complex arrangement of carbon, hydrogen, and oxygen atoms, contributing to its biological activity. The CAS number 145042-06-4 uniquely identifies this compound in chemical databases, facilitating research and regulatory processes. As with many natural products, the extraction and purification of scammonin VIII can be challenging, and its stability may be influenced by environmental factors such as temperature and pH. Further studies are often required to fully elucidate its mechanisms of action and potential therapeutic applications. Overall, scammonin VIII represents an interesting area of study within natural product chemistry and pharmacognosy.
Formula:C50H84O22
InChI:InChI=1/C50H84O22/c1-8-11-17-20-29-21-18-15-13-12-14-16-19-22-32(53)67-43-39(70-47-38(59)37(58)40(31(24-52)66-47)68-45(60)25(4)9-2)28(7)63-50(44(43)69-46(61)26(5)10-3)72-42-36(57)34(55)30(23-51)65-49(42)71-41-35(56)33(54)27(6)62-48(41)64-29/h9,26-31,33-44,47-52,54-59H,8,10-24H2,1-7H3/b25-9+
Synonyms:- Hexadecanoic acid, 11-((O-(E)-4-O-(2-methyl-1-oxo-2-butenyl)-beta-D-glucopyranosyl-(1-4)-O-(S)-6-deoxy-2-O-(2-methyl-1-oxobutyl)-alpha-L-mannopyranosyl-(1-2)-O-beta-D-glucopyranosyl-(1-2)-6-deoxy-beta-D-glucopyranosyl)oxy)-, intramol, 1,3'''-ester, (S)-
- (S)-11-((O-(E)-4-O-(2-Methyl-1-oxo-2-butenyl)-beta-D-glucopyranosyl-(1-4)-O-(S)-6-deoxy-2-O-(2-methyl-1-oxobutyl)-alpha-L-mannopyranosyl-(1-2)-O-beta-D-glucopyranosyl-(1-2)-6-deoxy-beta-D-glucopyranosyl)oxy)hexadecanoic acid intramol, 1,3'''-ester
- Scammonin viii
- 4,5-dihydroxy-2-(hydroxymethyl)-6-({4,5,11,12-tetrahydroxy-6-(hydroxymethyl)-13,31-dimethyl-33-[(2-methylbutanoyl)oxy]-27-oxo-17-pentyl-2,7,9,14,16,28,32-heptaoxatetracyclo[27.3.1.03,8.010,15]tritriacont-30-yl}oxy)tetrahydro-2H-pyran-3-yl (2E)-2-methylbut-2-enoate (non-preferred name)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Scammonin viii
CAS:Scammonin viii is a resin glycoside from Convolvulus scammonia.Formula:C50H84O22Color and Shape:SolidMolecular weight:1037.2
