CymitQuimica logo

CAS 145099-44-1

:

2-Pyridinesulfonamide,3-hydroxy-(9CI)

Description:
2-Pyridinesulfonamide, 3-hydroxy- (9CI), with the CAS number 145099-44-1, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a sulfonamide functional group, which is known for its antibacterial properties, and a hydroxyl group (-OH) at the 3-position of the pyridine ring. The presence of these functional groups contributes to its potential biological activity, making it of interest in medicinal chemistry. Typically, sulfonamides exhibit properties such as solubility in polar solvents and the ability to form hydrogen bonds due to the hydroxyl group. The compound may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, owing to the electron-withdrawing nature of the sulfonamide group. Overall, 2-Pyridinesulfonamide, 3-hydroxy- is a compound that combines features of both aromatic and functionalized organic chemistry, with implications for pharmaceutical applications.
Formula:C5H6N2O3S
InChI:InChI=1S/C5H6N2O3S/c6-11(9,10)5-4(8)2-1-3-7-5/h1-3,8H,(H2,6,9,10)
InChI key:ZHYAXTKFHYTYSM-UHFFFAOYSA-N
SMILES:C1=CC(=C(N=C1)S(=O)(=O)N)O
Found 4 products.