CymitQuimica logo

CAS 1451-20-3

:

(6aR,10aR)-6a,7,10,10a-Tetrahydro-1-methoxy-6,6,9-trimethyl-3-pentyl-6H-dibenzo[b,d]pyran

Description:
The chemical substance known as (6aR,10aR)-6a,7,10,10a-Tetrahydro-1-methoxy-6,6,9-trimethyl-3-pentyl-6H-dibenzo[b,d]pyran, with the CAS number 1451-20-3, is a complex organic compound characterized by its unique bicyclic structure, which includes a dibenzo[b,d]pyran moiety. This compound features multiple methyl groups and a methoxy group, contributing to its hydrophobic nature and potential lipophilicity. The stereochemistry indicated by the (6aR,10aR) configuration suggests specific spatial arrangements of its substituents, which can influence its biological activity and interactions. Typically, compounds of this type may exhibit various pharmacological properties, potentially acting as cannabinoids or having effects on the central nervous system. Its solubility profile, stability under different conditions, and reactivity with other chemical species would be essential for understanding its applications in medicinal chemistry or as a synthetic intermediate. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry due to its structural complexity and potential therapeutic implications.
Formula:C22H32O2
InChI:InChI=1S/C22H32O2/c1-6-7-8-9-16-13-19(23-5)21-17-12-15(2)10-11-18(17)22(3,4)24-20(21)14-16/h10,13-14,17-18H,6-9,11-12H2,1-5H3/t17-,18-/m1/s1
InChI key:InChIKey=GRLARWXSTOXAGR-QZTJIDSGSA-N
SMILES:O(C)C1=C2[C@]3([C@](C(C)(C)OC2=CC(CCCCC)=C1)(CC=C(C)C3)[H])[H]
Synonyms:
  • 6H-Dibenzo[b,d]pyran, 6a,7,10,10a-tetrahydro-1-methoxy-6,6,9-trimethyl-3-pentyl-, (6aR,10aR)-
  • 6H-Dibenzo[b,d]pyran, 6aα,7,10,10aβ-tetrahydro-1-methoxy-6,6,9-trimethyl-3-pentyl-
  • Δ6-Tetrahydrocannabinol methyl ether
  • 6H-Dibenzo[b,d]pyran, 6a,7,10,10a-tetrahydro-1-methoxy-6,6,9-trimethyl-3-pentyl-, (6aR-trans)-
  • (6aR,10aR)-6a,7,10,10a-Tetrahydro-1-methoxy-6,6,9-trimethyl-3-pentyl-6H-dibenzo[b,d]pyran
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.