CAS 1451-99-6: 2,2,4,4,6,6,8,8-Octaethylcyclotetrasiloxane

Description:2,2,4,4,6,6,8,8-Octaethylcyclotetrasiloxane, commonly referred to as OECTS, is a cyclic siloxane compound characterized by its unique structure consisting of a siloxane ring with eight ethyl groups attached to the silicon atoms. This compound exhibits low volatility and high thermal stability, making it suitable for various applications, including as a silicone polymer precursor and in formulations for personal care products. OECTS is known for its hydrophobic properties, which contribute to its effectiveness as a water-repellent agent. Additionally, it has a relatively low surface tension, enhancing its ability to spread and form films. The compound is generally considered to have low toxicity, but its environmental persistence raises concerns regarding bioaccumulation and potential ecological impacts. As with many siloxanes, its behavior in the environment and interactions with biological systems are subjects of ongoing research, particularly in the context of sustainability and regulatory assessments.

Formula:C₁₆H₄₀O₄Si₄

InChI:InChI=1S/C16H40O4Si4/c1-9-21(10-2)17-22(11-3,12-4)19-24(15-7,16-8)20-23(13-5,14-6)18-21/h9-16H2,1-8H3

InChI key:InChIKey=XOCOMEGNVMCRMP-UHFFFAOYSA-N

SMILES:O1[Si](O[Si](O[Si](O[Si]1(CC)CC)(CC)CC)(CC)CC)(CC)CC