CAS 1451042-19-5

N-(2-Aminophenyl)-5-[1-[2-(3-nitrophenyl)ethyl]-1H-1,2,3-triazol-4-yl]-2-thiophenecarboxamide

Description:

N-(2-Aminophenyl)-5-[1-[2-(3-nitrophenyl)ethyl]-1H-1,2,3-triazol-4-yl]-2-thiophenecarboxamide is a complex organic compound characterized by its multi-functional structure, which includes an amine group, a triazole ring, and a thiophene moiety. The presence of the 3-nitrophenyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the nitro group's ability to participate in various chemical reactions. The compound's structure indicates it may exhibit biological activity, possibly as an antimicrobial or anticancer agent, owing to the diverse functionalities that can interact with biological targets. Additionally, the thiophene ring contributes to the compound's electronic properties, which may enhance its reactivity and solubility in organic solvents. The CAS number 1451042-19-5 uniquely identifies this substance, facilitating its recognition in chemical databases and literature. Overall, this compound represents a significant interest in synthetic organic chemistry and drug development.

Formula: C₂₁H₁₈N₆O₃S

InChI: InChI=1S/C21H18N6O3S/c22-16-6-1-2-7-17(16)23-21(28)20-9-8-19(31-20)18-13-26(25-24-18)11-10-14-4-3-5-15(12-14)27(29)30/h1-9,12-13H,10-11,22H2,(H,23,28)

InChI key: InChIKey=AXAUXMXVFLCQQK-UHFFFAOYSA-N

SMILES: C(NC1=C(N)C=CC=C1)(=O)C=2SC(=CC2)C3=CN(CCC4=CC(N(=O)=O)=CC=C4)N=N3

Synonyms:

• N-(2-Aminophenyl)-5-[1-[2-(3-nitrophenyl)ethyl]-1H-1,2,3-triazol-4-yl]-2-thiophenecarboxamide
• 2-Thiophenecarboxamide, N-(2-aminophenyl)-5-[1-[2-(3-nitrophenyl)ethyl]-1H-1,2,3-triazol-4-yl]-

HDAC3-IN-T326

CAS: 1451042-19-5

HDAC3-IN-T326: potent, selective HDAC3 inhibitor, boosts NF-κB acetylation, activates latent HIV gene expression.

Formula: C₂₁H₁₈N₆O₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 434.47

Ref: TM-T24132