CAS 145108-33-4
:scammonin VII
Description:
Scammonin VII is a chemical compound classified as a glycoside, specifically derived from the plant species *Convolvulus scammonia*, commonly known for its medicinal properties. This compound is characterized by its complex structure, which includes a sugar moiety linked to an aglycone, contributing to its biological activity. Scammonin VII is known for its potential pharmacological effects, including anti-inflammatory and analgesic properties, making it of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in pharmaceutical formulations. Additionally, the compound's interactions with biological systems are an area of ongoing research, as they may reveal insights into its mechanism of action and therapeutic potential. As with many natural products, the extraction and purification processes are essential for obtaining scammonin VII in a form suitable for study and application. Overall, this compound exemplifies the rich diversity of bioactive substances derived from natural sources.
Formula:C50H84O21
InChI:InChI=1/C50H84O21/c1-9-12-18-21-30-22-19-16-14-13-15-17-20-23-32(52)66-43-40(69-47-38(58)37(57)39(28(7)62-47)67-45(59)25(4)10-2)29(8)63-50(44(43)68-46(60)26(5)11-3)71-42-36(56)34(54)31(24-51)65-49(42)70-41-35(55)33(53)27(6)61-48(41)64-30/h10,26-31,33-44,47-51,53-58H,9,11-24H2,1-8H3/b25-10+
Synonyms:- Scammonin VII
- Hexadecanoic acid, 11-((O-(E)-6-deoxy-4-O-(2-methyl-1-oxo-2-butenyl)-beta-D-glucopyranosyl-(1-4)-O-(S)-6-deoxy-2-O-(2-methyl-1-oxobutyl)-alpha-L-mannopyranosyl-(1-2)-O-beta-D-glucopyranosyl-(1-2)-6-deoxy-beta-D-galactopyranosyl)oxy)-, intramol. 1,3'''-ester, (S)-
- Hexadecanoic acid, 11-[[O-(E)-6-deoxy-4-O-(2-methyl-1-oxo-2-butenyl)-β-D-glucopyranosyl-(1→4)-O-(S)-6-deoxy-2-O-(2-methyl-1-oxobutyl)-α-L-mannopyranosyl-(1→2)-O-β-D-glucopyranosyl-(1→2)-6-deoxy-β-D-galactopyranosyl]oxy]-, intramol. 1,3'''-ester, (S)- (9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Scammonin VII
CAS:<p>Scammonin VII is a resin glycoside from Convolvulus scammonia.</p>Formula:C50H84O21Color and Shape:SolidMolecular weight:1021.201
